EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H11F4N3O4 |
| Net Charge | 0 |
| Average Mass | 361.251 |
| Monoisotopic Mass | 361.06857 |
| SMILES | COc1c(N)nc(-c2ccc(C(F)(F)F)c(OC)c2F)nc1C(=O)O |
| InChI | InChI=1S/C14H11F4N3O4/c1-24-9-6(14(16,17)18)4-3-5(7(9)15)12-20-8(13(22)23)10(25-2)11(19)21-12/h3-4H,1-2H3,(H,22,23)(H2,19,20,21) |
| InChIKey | WNQNYSQIBVZMHA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flufenauxirim (CHEBI:233989) has role herbicide (CHEBI:24527) |
| flufenauxirim (CHEBI:233989) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| flufenauxirim (CHEBI:233989) is a aminopyrimidine (CHEBI:38338) |
| flufenauxirim (CHEBI:233989) is a biaryl (CHEBI:64459) |
| flufenauxirim (CHEBI:233989) is a monofluorobenzenes (CHEBI:83575) |
| flufenauxirim (CHEBI:233989) is a monomethoxybenzene (CHEBI:25235) |
| flufenauxirim (CHEBI:233989) is a pyrimidinecarboxylic acid (CHEBI:78574) |
| IUPAC Name |
|---|
| 6-amino-2-[2-fluoro-3-methoxy-4-(trifluoromethyl)phenyl]-5-methoxypyrimidine-4-carboxylic acid |
| Synonyms | Source |
|---|---|
| 6-amino-2-[2-fluoro-3-methoxy-4-(trifluoromethyl)phenyl]-5-methoxy-4-pyrimidinecarboxylic acid | Alan Wood's Pesticides |
| flufènauxirime | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| flufenauxirim | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| CAS:3054208-46-4 | Alan Wood's Pesticides |