EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:233985 - RTI-83
| Formula | C18H25NO2 |
| Net Charge | 0 |
| Average Mass | 287.403 |
| Monoisotopic Mass | 287.18853 |
| SMILES | [H][C@@]12CC[C@@]([H])(N1C)[C@@]([H])(C(=O)OC)[C@@]([H])(c1ccc(CC)cc1)C2 |
| InChI | InChI=1S/C18H25NO2/c1-4-12-5-7-13(8-6-12)15-11-14-9-10-16(19(14)2)17(15)18(20)21-3/h5-8,14-17H,4,9-11H2,1-3H3/t14-,15+,16+,17-/m0/s1 |
| InChIKey | UAMCGXVVAUEEEU-HZMVEIRTSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | dopamine uptake inhibitor A dopaminergic agent that blocks the transport of dopamine into axon terminals or into storage vesicles within terminals. Most of the adrenergic uptake inhibitors also inhibit dopamine uptake. serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. |
| Applications: | dopamine uptake inhibitor A dopaminergic agent that blocks the transport of dopamine into axon terminals or into storage vesicles within terminals. Most of the adrenergic uptake inhibitors also inhibit dopamine uptake. serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| RTI-83 (CHEBI:233985) has role dopamine uptake inhibitor (CHEBI:51039) |
| RTI-83 (CHEBI:233985) has role serotonin uptake inhibitor (CHEBI:50949) |
| RTI-83 (CHEBI:233985) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| methyl (1R,2S,3S,5S)-3-(4-ethylphenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate |
| Synonym | Source |
|---|---|
| (-)-2β-carbomethoxy-3β-(4-ethylphenyl)tropane | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| https://en.wikipedia.org/wiki/RTI-83 | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:155337-52-3 | SUBMITTER |
| Citations |
|---|