EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:233982 - cis-norbixin
| Formula | C24H28O4 |
| Net Charge | 0 |
| Average Mass | 380.484 |
| Monoisotopic Mass | 380.19876 |
| SMILES | [H]C(=C(C)/C([H])=C(\[H])C(=O)O)/C([H])=C([H])/C(C)=C([H])/C([H])=C([H])/C([H])=C(C)/C([H])=C([H])/C([H])=C(C)/C([H])=C(\[H])C(=O)O |
| InChI | InChI=1S/C24H28O4/c1-19(11-7-13-21(3)15-17-23(25)26)9-5-6-10-20(2)12-8-14-22(4)16-18-24(27)28/h5-18H,1-4H3,(H,25,26)(H,27,28)/b6-5+,11-7+,12-8+,17-15+,18-16+,19-9+,20-10+,21-13-,22-14+ |
| InChIKey | ZVKOASAVGLETCT-LRRSNBNMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bixa orellana (ncbitaxon:66672) | - | DOI (10.1021/JF011325H) |
| Roles Classification |
|---|
| Biological Role: | food colouring A food additive that imparts colour to food. In European countries, E-numbers for permitted food colours are from E 100 to E 199, divided into yellows (E 100-109), oranges (E 110-119), reds (E 120-129), blues and violets (E 130-139), greens (E 140-149), browns and blacks (E 150-159), and others (E 160-199). |
| Application: | food colouring A food additive that imparts colour to food. In European countries, E-numbers for permitted food colours are from E 100 to E 199, divided into yellows (E 100-109), oranges (E 110-119), reds (E 120-129), blues and violets (E 130-139), greens (E 140-149), browns and blacks (E 150-159), and others (E 160-199). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-norbixin (CHEBI:233982) has role food colouring (CHEBI:77182) |
| cis-norbixin (CHEBI:233982) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| (2E,4E,6E,8E,10E,12E,14E,16Z,18E)-4,8,13,17-tetramethylicosa-2,4,6,8,10,12,14,16,18-nonaenedioic acid |
| Synonyms | Source |
|---|---|
| annatto | SUBMITTER |
| C.I. Natural Orange 4 | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| CAS:1393-63-1 | SUBMITTER |
| Citations |
|---|