EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H14Br2N2O3S |
| Net Charge | 0 |
| Average Mass | 510.207 |
| Monoisotopic Mass | 507.90919 |
| SMILES | O=C(Nc1ccc(Br)cc1)c1cccc(S(=O)(=O)Nc2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C19H14Br2N2O3S/c20-14-4-8-16(9-5-14)22-19(24)13-2-1-3-18(12-13)27(25,26)23-17-10-6-15(21)7-11-17/h1-12,23H,(H,22,24) |
| InChIKey | SJJKUNDBFWUAQB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | inhibitor A substance that diminishes the rate of a chemical reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(4-bromophenyl)-3-[(4-bromophenyl)sulfamoyl]benzamide (CHEBI:233979) has role inhibitor (CHEBI:35222) |
| N-(4-bromophenyl)-3-[(4-bromophenyl)sulfamoyl]benzamide (CHEBI:233979) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| N-(4-bromophenyl)-3-[(4-bromophenyl)sulfamoyl]benzamide |
| Synonyms | Source |
|---|---|
| C2-8 | SUBMITTER |
| N-(4-Bromophenyl)-3-{[(4-bromophenyl)amino]sufonyl}benzamide | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| CAS:300670-16-0 | SUBMITTER |
| Citations |
|---|