EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H24O5 |
| Net Charge | 0 |
| Average Mass | 260.330 |
| Monoisotopic Mass | 260.16237 |
| SMILES | [H][C@](O)(CCC(=O)O)C(=O)OCCCCCCCC |
| InChI | InChI=1S/C13H24O5/c1-2-3-4-5-6-7-10-18-13(17)11(14)8-9-12(15)16/h11,14H,2-10H2,1H3,(H,15,16)/t11-/m0/s1 |
| InChIKey | UJZOKTKSGUOCCM-NSHDSACASA-N |
| Roles Classification |
|---|
| Biological Role: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4S)-4-hydroxy-5-octoxy-5-oxopentanoic acid (CHEBI:233976) has role animal metabolite (CHEBI:75767) |
| (4S)-4-hydroxy-5-octoxy-5-oxopentanoic acid (CHEBI:233976) is a organic molecular entity (CHEBI:50860) |
| Synonym | Source |
|---|---|
| (2S)-Octyl-α-hydroxyglutarate | SUBMITTER |
| Citations |
|---|