EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28O2S2 |
| Net Charge | 0 |
| Average Mass | 388.598 |
| Monoisotopic Mass | 388.15307 |
| SMILES | O=C(O)CCCCC(CCSCc1ccccc1)SCc1ccccc1 |
| InChI | InChI=1S/C22H28O2S2/c23-22(24)14-8-7-13-21(26-18-20-11-5-2-6-12-20)15-16-25-17-19-9-3-1-4-10-19/h1-6,9-12,21H,7-8,13-18H2,(H,23,24) |
| InChIKey | ZYRLHJIMTROTBO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6,8-bis(benzylsulfanyl)octanoic acid (CHEBI:233958) is a benzenes (CHEBI:22712) |
| 6,8-bis(benzylsulfanyl)octanoic acid (CHEBI:233958) is a monocarboxylic acid (CHEBI:25384) |
| 6,8-bis(benzylsulfanyl)octanoic acid (CHEBI:233958) is a organic sulfide (CHEBI:16385) |
| Incoming Relation(s) |
| (6R)-6,8-bis(benzylsulfanyl)octanoic acid (CHEBI:233959) is a 6,8-bis(benzylsulfanyl)octanoic acid (CHEBI:233958) |
| (6S)-6,8-bis(benzylsulfanyl)octanoic acid (CHEBI:233960) is a 6,8-bis(benzylsulfanyl)octanoic acid (CHEBI:233958) |
| IUPAC Name |
|---|
| 6,8-bis(benzylsulfanyl)octanoic acid |
| Synonyms | Source |
|---|---|
| 6,8-bis(benzylthio)octanoic acid | IUPAC |
| 6,8-bis-benzylthio-octanoic acid | ChEBI |
| 6,8-bis[(phenylmethyl)thio]octanoic acid | ChEBI |