EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13NO3 |
| Net Charge | 0 |
| Average Mass | 195.218 |
| Monoisotopic Mass | 195.08954 |
| SMILES | COc1cccc(C[C@@H](N)C(=O)O)c1 |
| InChI | InChI=1S/C10H13NO3/c1-14-8-4-2-3-7(5-8)6-9(11)10(12)13/h2-5,9H,6,11H2,1H3,(H,12,13)/t9-/m1/s1 |
| InChIKey | XTXGLOBWOMUGQB-SECBINFHSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-methoxy-D-phenylalanine (CHEBI:233952) is a D-phenylalanine derivative (CHEBI:84143) |
| 3-methoxy-D-phenylalanine (CHEBI:233952) is a 3-methoxyphenylalanine (CHEBI:233951) |
| 3-methoxy-D-phenylalanine (CHEBI:233952) is enantiomer of 3-methoxy-L-phenylalanine (CHEBI:233134) |
| Incoming Relation(s) |
| 3-methoxy-L-phenylalanine (CHEBI:233134) is enantiomer of 3-methoxy-D-phenylalanine (CHEBI:233952) |
| IUPAC Name |
|---|
| 3-methoxy-D-phenylalanine |
| Synonyms | Source |
|---|---|
| (2R)-2-amino-3-(3-methoxyphenyl)propanoic acid | IUPAC |
| (R)-2-amino-3-(3-methoxyphenyl)propanoic acid | ChEBI |
| H-D-Phe(3-OMe)-OH | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:145306-65-6 | ChEBI |