EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20N2O3 |
| Net Charge | 0 |
| Average Mass | 288.347 |
| Monoisotopic Mass | 288.14739 |
| SMILES | CCCCC(=O)N[C@@H](Cc1cnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C16H20N2O3/c1-2-3-8-15(19)18-14(16(20)21)9-11-10-17-13-7-5-4-6-12(11)13/h4-7,10,14,17H,2-3,8-9H2,1H3,(H,18,19)(H,20,21)/t14-/m0/s1 |
| InChIKey | JROXMYGUCMIQQD-AWEZNQCLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| valeryltryptophan (CHEBI:233944) is a N-acyl-L-amino acid (CHEBI:21644) |
| IUPAC Name |
|---|
| (2S)-3-(1H-indol-3-yl)-2-(pentanoylamino)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 71253845 | ChemSpider |