EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H14N2O6 |
| Net Charge | 0 |
| Average Mass | 246.219 |
| Monoisotopic Mass | 246.08519 |
| SMILES | NC(=O)CC[C@H](NC(=O)CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C9H14N2O6/c10-6(12)2-1-5(9(16)17)11-7(13)3-4-8(14)15/h5H,1-4H2,(H2,10,12)(H,11,13)(H,14,15)(H,16,17)/t5-/m0/s1 |
| InChIKey | RLYZAJHMBJUMAP-YFKPBYRVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| succinylglutamine (CHEBI:233940) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| (2S)-5-amino-2-(3-carboxypropanoylamino)-5-oxopentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| ZKO | PDBeChem |