EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H15NO4 |
| Net Charge | 0 |
| Average Mass | 237.255 |
| Monoisotopic Mass | 237.10011 |
| SMILES | C[C@@H](O)[C@H](NC(=O)Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C12H15NO4/c1-8(14)11(12(16)17)13-10(15)7-9-5-3-2-4-6-9/h2-6,8,11,14H,7H2,1H3,(H,13,15)(H,16,17)/t8-,11+/m1/s1 |
| InChIKey | ZTAVORUYXADUPD-KCJUWKMLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenylacetylthreonine (CHEBI:233931) is a N-acyl-L-amino acid (CHEBI:21644) |
| IUPAC Name |
|---|
| (2S,3R)-3-hydroxy-2-[(2-phenylacetyl)amino]butanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 50732194 | ChemSpider |