EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H34N2O8 |
| Net Charge | 0 |
| Average Mass | 418.487 |
| Monoisotopic Mass | 418.23152 |
| SMILES | CC(CC(=O)C(C(=O)[O-])C(O)C[N+](C)(C)C)C(=O)C(C(=O)[O-])C(O)C[N+](C)(C)C |
| InChI | InChI=1S/C19H34N2O8/c1-11(17(25)16(19(28)29)14(24)10-21(5,6)7)8-12(22)15(18(26)27)13(23)9-20(2,3)4/h11,13-16,23-24H,8-10H2,1-7H3 |
| InChIKey | ZCVILQFQYXCJMK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methylsuccinoylcarnitine (CHEBI:233911) is a oxo carboxylic acid (CHEBI:25754) |