EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H4Cl2O4 |
| Net Charge | 0 |
| Average Mass | 223.011 |
| Monoisotopic Mass | 221.94866 |
| SMILES | O=C(O)c1c(O)c(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C7H4Cl2O4/c8-2-1-3(9)6(11)4(5(2)10)7(12)13/h1,10-11H,(H,12,13) |
| InChIKey | KLXACYSQYFWVLM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,5-dichloro-2,6-dihydroxybenzoic acid (CHEBI:233880) is a chlorobenzoic acid (CHEBI:23134) |
| IUPAC Name |
|---|
| 3,5-dichloro-2,6-dihydroxybenzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 24339141 | ChemSpider |
| HMDB0242164 | HMDB |