EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H11N3 |
| Net Charge | 0 |
| Average Mass | 197.241 |
| Monoisotopic Mass | 197.09530 |
| SMILES | Nc1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C12H11N3/c13-10-6-8-12(9-7-10)15-14-11-4-2-1-3-5-11/h1-9H,13H2/b15-14+ |
| InChIKey | QPQKUYVSJWQSDY-CCEZHUSRSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| Application: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(phenylazo)aniline (CHEBI:233869) has functional parent azobenzene (CHEBI:190358) |
| 4-(phenylazo)aniline (CHEBI:233869) has role allergen (CHEBI:50904) |
| 4-(phenylazo)aniline (CHEBI:233869) has role dye (CHEBI:37958) |
| 4-(phenylazo)aniline (CHEBI:233869) is a azobenzenes (CHEBI:22682) |
| 4-(phenylazo)aniline (CHEBI:233869) is a primary arylamine (CHEBI:50471) |
| IUPAC Name |
|---|
| 4-[(E)-phenyldiazenyl]aniline |
| Synonyms | Source |
|---|---|
| 4-Phenylazo-phenylamine | ChEMBL |
| p-aminoazobenzene | ChemIDplus |
| AAB | ChEBI |
| Aniline Yellow | ChemIDplus |
| 4-(Phenylazo)benzenamine | ChemIDplus |
| 4-Amino-1,1'-azobenzene | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Aniline_Yellow | Wikipedia |
| C19187 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:513850 | Reaxys |
| CAS:60-09-3 | ChemIDplus |
| CAS:60-09-3 | KEGG COMPOUND |
| Citations |
|---|