EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H5NO3 |
| Net Charge | 0 |
| Average Mass | 139.110 |
| Monoisotopic Mass | 139.02694 |
| SMILES | O=C(O)c1ccncc1O |
| InChI | InChI=1S/C6H5NO3/c8-5-3-7-2-1-4(5)6(9)10/h1-3,8H,(H,9,10) |
| InChIKey | JEHGATQUCUYHJL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxyisonicotinic acid (CHEBI:233867) is a aromatic carboxylic acid (CHEBI:33859) |
| 3-hydroxyisonicotinic acid (CHEBI:233867) is a pyridines (CHEBI:26421) |
| IUPAC Name |
|---|
| 3-hydroxypyridine-4-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 404406 | ChemSpider |