EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H11NO3 |
| Net Charge | 0 |
| Average Mass | 157.169 |
| Monoisotopic Mass | 157.07389 |
| SMILES | CCC=CC(=O)[C@H](N)C(=O)O |
| InChI | InChI=1S/C7H11NO3/c1-2-3-4-5(9)6(8)7(10)11/h3-4,6H,2,8H2,1H3,(H,10,11)/t6-/m0/s1 |
| InChIKey | KEFYRHWDQYDTOR-LURJTMIESA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-pentenoylglycine (CHEBI:233860) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 2-amino-3-oxohept-4-enoic acid |