EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H48O4 |
| Net Charge | 0 |
| Average Mass | 436.677 |
| Monoisotopic Mass | 436.35526 |
| SMILES | CC(CO)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3C[C@@H](O)[C@@]4(O)C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H48O4/c1-17(16-28)6-5-7-18(2)21-8-9-22-20-14-24(30)27(31)15-19(29)10-13-26(27,4)23(20)11-12-25(21,22)3/h17-24,28-31H,5-16H2,1-4H3/t17?,18-,19+,20+,21-,22+,23+,24-,25-,26-,27+/m1/s1 |
| InChIKey | PFYSRSDOSXYIFG-DUNVRISLSA-N |
| Roles Classification |
|---|
| Biological Role: | bile acid metabolite Metabolites of bile acids, four-ringed steroid acids formed along the cholesterol degradation pathway. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cholestane-3,5,6,26-tetrol (CHEBI:233823) has parent hydride cholestane (CHEBI:35516) |
| Cholestane-3,5,6,26-tetrol (CHEBI:233823) has role bile acid metabolite (CHEBI:48887) |
| Cholestane-3,5,6,26-tetrol (CHEBI:233823) is a 26-hydroxy steroid (CHEBI:36852) |
| Cholestane-3,5,6,26-tetrol (CHEBI:233823) is a 3-hydroxy steroid (CHEBI:36834) |
| Cholestane-3,5,6,26-tetrol (CHEBI:233823) is a 5-hydroxy steroid (CHEBI:36848) |
| Cholestane-3,5,6,26-tetrol (CHEBI:233823) is a 6-hydroxy steroid (CHEBI:36849) |
| Cholestane-3,5,6,26-tetrol (CHEBI:233823) is a cholestanoid (CHEBI:50401) |
| IUPAC Name |
|---|
| (1R,3aS,3bS,5R,5aR,7S,9aR,9bS,11aR)-1-[(2R)-7-hydroxy-6-methylheptan-2-yl]-9a,11a-dimethyl-hexadecahydro-1H-cyclopenta[a]phenanthrene-5,5a,7-triol |
| Synonym | Source |
|---|---|
| Cholestane-3S,5R,6R,26-tetrol | SUBMITTER |
| Citations |
|---|