EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:233812 - 3-O-carboxymethylmorphine
| Formula | C19H21NO5 |
| Net Charge | 0 |
| Average Mass | 343.379 |
| Monoisotopic Mass | 343.14197 |
| SMILES | [H][C@@]12C=C[C@H](O)[C@@H]3Oc4c(OCC(=O)O)ccc5c4[C@@]31CCN(C)[C@@H]2C5 |
| InChI | InChI=1S/C19H21NO5/c1-20-7-6-19-11-3-4-13(21)18(19)25-17-14(24-9-15(22)23)5-2-10(16(17)19)8-12(11)20/h2-5,11-13,18,21H,6-9H2,1H3,(H,22,23)/t11-,12+,13-,18-,19-/m0/s1 |
| InChIKey | KCYXYAIVKQSDFP-WMRVMTBBSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-O-carboxymethylmorphine (CHEBI:233812) has functional parent morphine (CHEBI:17303) |
| 3-O-carboxymethylmorphine (CHEBI:233812) has role hapten (CHEBI:59174) |
| 3-O-carboxymethylmorphine (CHEBI:233812) is a ether (CHEBI:25698) |
| 3-O-carboxymethylmorphine (CHEBI:233812) is a monocarboxylic acid (CHEBI:25384) |
| 3-O-carboxymethylmorphine (CHEBI:233812) is a morphinane alkaloid (CHEBI:25418) |
| 3-O-carboxymethylmorphine (CHEBI:233812) is a organic heteropentacyclic compound (CHEBI:38164) |
| 3-O-carboxymethylmorphine (CHEBI:233812) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| [(6α-hydroxy-17-methyl-5α-7,8-didehydro-4,5-epoxymorphinan-3-yl)oxy]acetic acid |
| Synonym | Source |
|---|---|
| 3-O-carboxymethyl morphine | ChEBI |
| Citations |
|---|