EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H23NO6 |
| Net Charge | 0 |
| Average Mass | 385.416 |
| Monoisotopic Mass | 385.15254 |
| SMILES | [H][C@@]12C=C[C@H](OC(=O)CCC(=O)O)[C@@H]3Oc4c(O)ccc5c4[C@@]31CCN(C)[C@@H]2C5 |
| InChI | InChI=1S/C21H23NO6/c1-22-9-8-21-12-3-5-15(27-17(26)7-6-16(24)25)20(21)28-19-14(23)4-2-11(18(19)21)10-13(12)22/h2-5,12-13,15,20,23H,6-10H2,1H3,(H,24,25)/t12-,13+,15-,20-,21-/m0/s1 |
| InChIKey | RVCMQOUQLRUENR-XSFUTMHBSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| morphine-6-hemisuccinate (CHEBI:233811) has functional parent morphine (CHEBI:17303) |
| morphine-6-hemisuccinate (CHEBI:233811) has role hapten (CHEBI:59174) |
| morphine-6-hemisuccinate (CHEBI:233811) has role opioid analgesic (CHEBI:35482) |
| morphine-6-hemisuccinate (CHEBI:233811) is a dicarboxylic acid monoester (CHEBI:36244) |
| morphine-6-hemisuccinate (CHEBI:233811) is a morphinane alkaloid (CHEBI:25418) |
| morphine-6-hemisuccinate (CHEBI:233811) is a organic heteropentacyclic compound (CHEBI:38164) |
| morphine-6-hemisuccinate (CHEBI:233811) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 4-[(3-hydroxy-17-methyl-5α-7,8-didehydro-4,5-epoxymorphinan-6α-yl)oxy]-4-oxobutanoic acid |
| Synonyms | Source |
|---|---|
| 6-succinyl morphine | ChEBI |
| 6-succinylmorphine | ChEBI |
| morphine 6-hemisuccinate | ChEBI |
| morphine-6-succinate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:36507-55-8 | ChEBI |
| Citations |
|---|