EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H30N2O2 |
| Net Charge | 0 |
| Average Mass | 366.505 |
| Monoisotopic Mass | 366.23073 |
| SMILES | CCC(=O)N(c1ccc(OC)cc1)C1CCN(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C23H30N2O2/c1-3-23(26)25(20-9-11-22(27-2)12-10-20)21-14-17-24(18-15-21)16-13-19-7-5-4-6-8-19/h4-12,21H,3,13-18H2,1-2H3 |
| InChIKey | QKQAUPIOVFHVJI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| Applications: | mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| para-methoxyfentanyl (CHEBI:233771) has role opioid analgesic (CHEBI:35482) |
| para-methoxyfentanyl (CHEBI:233771) has role μ-opioid receptor agonist (CHEBI:55322) |
| para-methoxyfentanyl (CHEBI:233771) is a monocarboxylic acid amide (CHEBI:29347) |
| para-methoxyfentanyl (CHEBI:233771) is a monomethoxybenzene (CHEBI:25235) |
| para-methoxyfentanyl (CHEBI:233771) is a piperidines (CHEBI:26151) |
| para-methoxyfentanyl (CHEBI:233771) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N-(4-methoxyphenyl)-N-[1-(2-phenylethyl)piperidin-4-yl]propanamide |
| Synonyms | Source |
|---|---|
| 4-methoxyfentanyl | ChEBI |
| N-(4-methoxyphenyl)-N-(1-(2-phenylethyl)-4-piperidinyl)propanamide | ChEBI |
| N-(4-methoxyphenyl)-N-(1-phenethyl-4-piperidinyl)propanamide | ChEBI |
| p-methoxyfentanyl | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| P-Methoxyfentanyl | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:1688-41-1 | ChEBI |
| Citations |
|---|