EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H13O3 |
| Net Charge | -1 |
| Average Mass | 157.189 |
| Monoisotopic Mass | 157.08702 |
| SMILES | CCCC(=O)C(CC)C(=O)[O-] |
| InChI | InChI=1S/C8H14O3/c1-3-5-7(9)6(4-2)8(10)11/h6H,3-5H2,1-2H3,(H,10,11)/p-1 |
| InChIKey | DKHKWOWKZHBBGV-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-Ethyl-3-keto-hexanoic acid (CHEBI:233766) has role human metabolite (CHEBI:77746) |
| 2-Ethyl-3-keto-hexanoic acid (CHEBI:233766) is a 3-oxo monocarboxylic acid (CHEBI:47881) |
| IUPAC Name |
|---|
| 2-ethyl-3-oxohexanoic acid |
| Citations |
|---|