EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20O4 |
| Net Charge | -2 |
| Average Mass | 228.288 |
| Monoisotopic Mass | 228.13726 |
| SMILES | CC(CCCC(C)CC(=O)[O-])CCC(=O)[O-] |
| InChI | InChI=1S/C12H22O4/c1-9(6-7-11(13)14)4-3-5-10(2)8-12(15)16/h9-10H,3-8H2,1-2H3,(H,13,14)(H,15,16)/p-2 |
| InChIKey | HYPIHGLKOQBQNW-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,7-dimethyldecanedioic acid (CHEBI:233743) has parent hydride sebacic acid (CHEBI:41865) |
| 3,7-dimethyldecanedioic acid (CHEBI:233743) has role human metabolite (CHEBI:77746) |
| 3,7-dimethyldecanedioic acid (CHEBI:233743) is a dicarboxylic fatty acid (CHEBI:189840) |
| Incoming Relation(s) |
| 3,7-dimethyldecanedioic acid coa (CHEBI:233742) has functional parent 3,7-dimethyldecanedioic acid (CHEBI:233743) |
| Citations |
|---|