EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O3 |
| Net Charge | 0 |
| Average Mass | 178.187 |
| Monoisotopic Mass | 178.06299 |
| SMILES | COc1cc(/C=C/C=O)ccc1O |
| InChI | InChI=1S/C10H10O3/c1-13-10-7-8(3-2-6-11)4-5-9(10)12/h2-7,12H,1H3/b3-2+ |
| InChIKey | DKZBBWMURDFHNE-NSCUHMNNSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| coniferyl aldehyde (CHEBI:16547) has functional parent (E)-cinnamaldehyde (CHEBI:16731) |
| coniferyl aldehyde (CHEBI:16547) has role antifungal agent (CHEBI:35718) |
| coniferyl aldehyde (CHEBI:16547) has role plant metabolite (CHEBI:76924) |
| coniferyl aldehyde (CHEBI:16547) is a cinnamaldehydes (CHEBI:23245) |
| coniferyl aldehyde (CHEBI:16547) is a guaiacols (CHEBI:134251) |
| coniferyl aldehyde (CHEBI:16547) is a phenylpropanoid (CHEBI:26004) |
| Incoming Relation(s) |
| coniferaldehyde β-D-glucoside (CHEBI:136949) has functional parent coniferyl aldehyde (CHEBI:16547) |
| IUPAC Name |
|---|
| 3-(4-hydroxy-3-methoxyphenyl)prop-2-enal |
| Synonyms | Source |
|---|---|
| 4-hydroxy-3-methoxycinnamaldehyde | ChEBI |
| 4-Hydroxy-3-methoxycinnamaldehyde | KEGG COMPOUND |
| Coniferaldehyde | KEGG COMPOUND |
| Coniferyl aldehyde | KEGG COMPOUND |
| Ferulaldehyde | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| (E)-coniferaldehyde | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00002728 | KNApSAcK |
| C02666 | KEGG COMPOUND |
| C02666 | KEGG COMPOUND |
| Coniferyl_aldehyde | Wikipedia |
| CONIFERYL-ALDEHYDE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2048208 | Reaxys |
| CAS:458-36-6 | ChemIDplus |
| CAS:458-36-6 | KEGG COMPOUND |
| Citations |
|---|