EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20O8 |
| Net Charge | 0 |
| Average Mass | 340.328 |
| Monoisotopic Mass | 340.11582 |
| SMILES | COc1cc(/C=C/C=O)ccc1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C16H20O8/c1-22-11-7-9(3-2-6-17)4-5-10(11)23-16-15(21)14(20)13(19)12(8-18)24-16/h2-7,12-16,18-21H,8H2,1H3/b3-2+/t12-,13-,14+,15-,16-/m1/s1 |
| InChIKey | PJFKUPRDDXTASO-FAOXUISGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | |||
| - | PubMed (27656890) | ||
| - | MetaboLights (MTBLS272) | ||
| Eucommia ulmoides (ncbitaxon:4392) | bark (BTO:0001301) | PubMed (23847077) | |
| Ginkgo biloba (ncbitaxon:3311) | - | PubMed (15986215) |
| Roles Classification |
|---|
| Biological Role: | Arabidopsis thaliana metabolite Any plant metabolite that is produced by Arabidopsis thaliana. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| coniferaldehyde β-D-glucoside (CHEBI:136949) has functional parent coniferyl aldehyde (CHEBI:16547) |
| coniferaldehyde β-D-glucoside (CHEBI:136949) has role Arabidopsis thaliana metabolite (CHEBI:140602) |
| coniferaldehyde β-D-glucoside (CHEBI:136949) is a enal (CHEBI:51688) |
| coniferaldehyde β-D-glucoside (CHEBI:136949) is a monomethoxybenzene (CHEBI:25235) |
| coniferaldehyde β-D-glucoside (CHEBI:136949) is a monosaccharide derivative (CHEBI:63367) |
| coniferaldehyde β-D-glucoside (CHEBI:136949) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 2-methoxy-4-[(1E)-3-oxoprop-1-en-1-yl]phenyl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| coniferaldehyde glucoside | ChEBI |
| coniferaldehyde O-β-D-glucoside | ChEBI |
| coniferaldehyde β-glucoside | ChEBI |
| ferulaldehyde β-D-glucoside | ChEBI |
| ferulaldehyde glucoside | ChEBI |
| ferulaldehyde β-glucoside | ChEBI |
| UniProt Name | Source |
|---|---|
| 4-O-(β-D-glucosyl)-4-(E)-coniferyl aldehyde | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-81 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:49673 | Reaxys |
| Citations |
|---|