EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H33N3O2S |
| Net Charge | 0 |
| Average Mass | 439.625 |
| Monoisotopic Mass | 439.22935 |
| SMILES | CCC(=O)N(c1ccccc1)C1CCN(CCc2ccc(NC(=O)CCS)cc2)CC1 |
| InChI | InChI=1S/C25H33N3O2S/c1-2-25(30)28(22-6-4-3-5-7-22)23-13-17-27(18-14-23)16-12-20-8-10-21(11-9-20)26-24(29)15-19-31/h3-11,23,31H,2,12-19H2,1H3,(H,26,29) |
| InChIKey | FYKZNPGCRLBNAZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| para-AmFenHap (CHEBI:233692) has role hapten (CHEBI:59174) |
| para-AmFenHap (CHEBI:233692) is a anilide (CHEBI:13248) |
| para-AmFenHap (CHEBI:233692) is a monocarboxylic acid amide (CHEBI:29347) |
| para-AmFenHap (CHEBI:233692) is a piperidines (CHEBI:26151) |
| para-AmFenHap (CHEBI:233692) is a secondary carboxamide (CHEBI:140325) |
| para-AmFenHap (CHEBI:233692) is a tertiary amino compound (CHEBI:50996) |
| para-AmFenHap (CHEBI:233692) is a thiol (CHEBI:29256) |
| IUPAC Name |
|---|
| N-phenyl-N-(1-{2-[4-(3-sulfanylpropanamido)phenyl]ethyl}piperidin-4-yl)propanamide |
| Synonyms | Source |
|---|---|
| N-(1-{2-[4-(3-mercaptopropanamido)phenyl]ethyl}piperidin-4-yl)-N-phenylpropanamide | IUPAC |
| p-AmFenHap | ChEBI |
| Citations |
|---|