EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H26N2O2 |
| Net Charge | 0 |
| Average Mass | 374.484 |
| Monoisotopic Mass | 374.19943 |
| SMILES | O=C(c1ccco1)N(c1ccccc1)C1CCN(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C24H26N2O2/c27-24(23-12-7-19-28-23)26(21-10-5-2-6-11-21)22-14-17-25(18-15-22)16-13-20-8-3-1-4-9-20/h1-12,19,22H,13-18H2 |
| InChIKey | FZJVHWISUGFFQV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. |
| Applications: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| furanylfentanyl (CHEBI:233684) has role opioid analgesic (CHEBI:35482) |
| furanylfentanyl (CHEBI:233684) has role μ-opioid receptor agonist (CHEBI:55322) |
| furanylfentanyl (CHEBI:233684) is a anilide (CHEBI:13248) |
| furanylfentanyl (CHEBI:233684) is a furans (CHEBI:24129) |
| furanylfentanyl (CHEBI:233684) is a monocarboxylic acid amide (CHEBI:29347) |
| furanylfentanyl (CHEBI:233684) is a piperidines (CHEBI:26151) |
| furanylfentanyl (CHEBI:233684) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N-phenyl-N-[1-(2-phenylethyl)piperidin-4-yl]furan-2-carboxamide |
| Synonyms | Source |
|---|---|
| N-(1-(2-phenylethyl)-4-piperidinyl)-N-phenylfuran-2-carboxamide | ChEBI |
| N-(1-phenethylpiperidin-4-yl)-N-phenylfuran-2-carboxamide | KEGG COMPOUND |
| N-phenyl-N-[1-(2-phenylethyl)-4-piperidinyl]-2-furancarboxamide | ChEBI |
| Fu-F | ChEBI |
| FUF | ChEBI |
| furanyl fentanyl | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C22761 | KEGG COMPOUND |
| Furanylfentanyl | Wikipedia |
| HMDB0259455 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:101345-66-8 | KEGG COMPOUND |
| Citations |
|---|