EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10O7S |
| Net Charge | 0 |
| Average Mass | 262.239 |
| Monoisotopic Mass | 262.01472 |
| SMILES | COC(=O)c1ccc(OS(=O)(=O)O)c(OC)c1 |
| InChI | InChI=1S/C9H10O7S/c1-14-8-5-6(9(10)15-2)3-4-7(8)16-17(11,12)13/h3-5H,1-2H3,(H,11,12,13) |
| InChIKey | IWRNHPTWPBSQSA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl vanillate sulfate (CHEBI:233677) is a acetate ester (CHEBI:47622) |
| methyl vanillate sulfate (CHEBI:233677) is a aryl sulfate (CHEBI:37919) |
| methyl vanillate sulfate (CHEBI:233677) is a methoxybenzoic acid (CHEBI:25238) |