EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20N2O4 |
| Net Charge | 0 |
| Average Mass | 304.346 |
| Monoisotopic Mass | 304.14231 |
| SMILES | C[C@@H](Cc1ccccc1)NCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C16H20N2O4/c1-12(11-13-5-3-2-4-6-13)17-10-9-16(21)22-18-14(19)7-8-15(18)20/h2-6,12,17H,7-11H2,1H3/t12-/m0/s1 |
| InChIKey | ILXQHRPAGLYUFH-LBPRGKRZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,5-dioxopyrrolidin-1-yl N-[(2S)-1-phenylpropan-2-yl]-β-alaninate (CHEBI:233674) has role hapten (CHEBI:59174) |
| 2,5-dioxopyrrolidin-1-yl N-[(2S)-1-phenylpropan-2-yl]-β-alaninate (CHEBI:233674) is a N-hydroxysuccinimide ester (CHEBI:53165) |
| 2,5-dioxopyrrolidin-1-yl N-[(2S)-1-phenylpropan-2-yl]-β-alaninate (CHEBI:233674) is a benzenes (CHEBI:22712) |
| 2,5-dioxopyrrolidin-1-yl N-[(2S)-1-phenylpropan-2-yl]-β-alaninate (CHEBI:233674) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| 2,5-dioxopyrrolidin-1-yl N-[(2S)-1-phenylpropan-2-yl]-β-alaninate |
| Synonym | Source |
|---|---|
| 1-[(3-{[(2S)-1-phenylpropan-2-yl]amino}propanoyl)oxy]pyrrolidine-2,5-dione | IUPAC |
| Citations |
|---|