EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H33N5O2 |
| Net Charge | 0 |
| Average Mass | 363.506 |
| Monoisotopic Mass | 363.26343 |
| SMILES | C[C@H](Cc1ccccc1)NCCNC(=O)CNC(=O)[C@H](N)CCCCN |
| InChI | InChI=1S/C19H33N5O2/c1-15(13-16-7-3-2-4-8-16)22-11-12-23-18(25)14-24-19(26)17(21)9-5-6-10-20/h2-4,7-8,15,17,22H,5-6,9-14,20-21H2,1H3,(H,23,25)(H,24,26)/t15-,17-/m1/s1 |
| InChIKey | ANJUAKMSKMWFMR-NVXWUHKLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-lysyl-N-(2-{[(2R)-1-phenylpropan-2-yl]amino}ethyl)glycinamide (CHEBI:233672) has role hapten (CHEBI:59174) |
| D-lysyl-N-(2-{[(2R)-1-phenylpropan-2-yl]amino}ethyl)glycinamide (CHEBI:233672) is a benzenes (CHEBI:22712) |
| D-lysyl-N-(2-{[(2R)-1-phenylpropan-2-yl]amino}ethyl)glycinamide (CHEBI:233672) is a primary amino compound (CHEBI:50994) |
| D-lysyl-N-(2-{[(2R)-1-phenylpropan-2-yl]amino}ethyl)glycinamide (CHEBI:233672) is a secondary amino compound (CHEBI:50995) |
| D-lysyl-N-(2-{[(2R)-1-phenylpropan-2-yl]amino}ethyl)glycinamide (CHEBI:233672) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| D-lysyl-N-(2-{[(2R)-1-phenylpropan-2-yl]amino}ethyl)glycinamide |
| Synonyms | Source |
|---|---|
| (2R)-2,6-diamino-N-{2-oxo-2-[(2-{[(2R)-1-phenylpropan-2-yl]amino}ethyl)amino]ethyl}hexanamide | IUPAC |
| (R)-2,6-diamino-N-(2-oxo-2-((2-(((R)-1-phenylpropan-2-yl)amino)ethyl)amino)ethyl)hexanamide | ChEBI |
| Citations |
|---|