EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H30N4O |
| Net Charge | 0 |
| Average Mass | 306.454 |
| Monoisotopic Mass | 306.24196 |
| SMILES | C[C@H](Cc1ccccc1)NCCNC(=O)C(N)CCCCN |
| InChI | InChI=1S/C17H30N4O/c1-14(13-15-7-3-2-4-8-15)20-11-12-21-17(22)16(19)9-5-6-10-18/h2-4,7-8,14,16,20H,5-6,9-13,18-19H2,1H3,(H,21,22)/t14-,16?/m1/s1 |
| InChIKey | RVYKQWQULLJTBL-IURRXHLWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(2-{[(2R)-1-phenylpropan-2-yl]amino}ethyl)lysinamide (CHEBI:233671) has role hapten (CHEBI:59174) |
| N-(2-{[(2R)-1-phenylpropan-2-yl]amino}ethyl)lysinamide (CHEBI:233671) is a benzenes (CHEBI:22712) |
| N-(2-{[(2R)-1-phenylpropan-2-yl]amino}ethyl)lysinamide (CHEBI:233671) is a primary amino compound (CHEBI:50994) |
| N-(2-{[(2R)-1-phenylpropan-2-yl]amino}ethyl)lysinamide (CHEBI:233671) is a secondary amino compound (CHEBI:50995) |
| N-(2-{[(2R)-1-phenylpropan-2-yl]amino}ethyl)lysinamide (CHEBI:233671) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| N-(2-{[(2R)-1-phenylpropan-2-yl]amino}ethyl)lysinamide |
| Synonyms | Source |
|---|---|
| 2,6-diamino-N-(2-{[(2R)-1-phenylpropan-2-yl]amino}ethyl)hexanamide | IUPAC |
| 2,6-diamino-N-(2-(((R)-1-phenylpropan-2-yl)amino)ethyl)hexanamide | ChEBI |
| Citations |
|---|