EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H31N3O4 |
| Net Charge | 0 |
| Average Mass | 401.507 |
| Monoisotopic Mass | 401.23146 |
| SMILES | [H][C@]12CC[C@]([H])([C@@H](C(=O)NCCCCCC(=O)O)[C@@H](NC(=O)c3ccccc3)C1)N2C |
| InChI | InChI=1S/C22H31N3O4/c1-25-16-11-12-18(25)20(22(29)23-13-7-3-6-10-19(26)27)17(14-16)24-21(28)15-8-4-2-5-9-15/h2,4-5,8-9,16-18,20H,3,6-7,10-14H2,1H3,(H,23,29)(H,24,28)(H,26,27)/t16-,17-,18+,20-/m0/s1 |
| InChIKey | YDSMKSOXBLPMIQ-GNBUJSLZSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GND (CHEBI:233670) has role hapten (CHEBI:59174) |
| GND (CHEBI:233670) is a azabicycloalkane (CHEBI:38295) |
| GND (CHEBI:233670) is a benzamides (CHEBI:22702) |
| GND (CHEBI:233670) is a monocarboxylic acid (CHEBI:25384) |
| GND (CHEBI:233670) is a secondary carboxamide (CHEBI:140325) |
| GND (CHEBI:233670) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 6-({[(1R,2S,3S,5S)-3-benzamido-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]carbonyl}amino)hexanoic acid |
| Synonyms | Source |
|---|---|
| 6-((1R,2S,3S,5S)-3-benzamido-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxamido)hexanoic acid | ChEBI |
| cocaine analog GND | ChEBI |
| cocaine hapten GND | ChEBI |
| GND hapten | ChEBI |
| hapten GND | ChEBI |
| Citations |
|---|