EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H44F2N6O2 |
| Net Charge | 0 |
| Average Mass | 546.707 |
| Monoisotopic Mass | 546.34938 |
| SMILES | COc1cc2c(NC3CCN(C(C)C)CC3)nc(N3CCC(F)(F)CC3)nc2cc1OCCCN1CCCC1 |
| InChI | InChI=1S/C29H44F2N6O2/c1-21(2)36-14-7-22(8-15-36)32-27-23-19-25(38-3)26(39-18-6-13-35-11-4-5-12-35)20-24(23)33-28(34-27)37-16-9-29(30,31)10-17-37/h19-22H,4-18H2,1-3H3,(H,32,33,34) |
| InChIKey | RNAMYOYQYRYFQY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| UNC0642 (CHEBI:233643) has role antineoplastic agent (CHEBI:35610) |
| UNC0642 (CHEBI:233643) has role apoptosis inducer (CHEBI:68495) |
| UNC0642 (CHEBI:233643) is a aminopiperidine (CHEBI:48588) |
| UNC0642 (CHEBI:233643) is a aromatic ether (CHEBI:35618) |
| UNC0642 (CHEBI:233643) is a organofluorine compound (CHEBI:37143) |
| UNC0642 (CHEBI:233643) is a pyrrolidines (CHEBI:38260) |
| UNC0642 (CHEBI:233643) is a quinazolines (CHEBI:38530) |
| UNC0642 (CHEBI:233643) is a secondary amino compound (CHEBI:50995) |
| UNC0642 (CHEBI:233643) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 2-(4,4-difluoropiperidin-1-yl)-6-methoxy-N-[1-(propan-2-yl)piperidin-4-yl]-7-[3-(pyrrolidin-1-yl)propoxy]quinazolin-4-amine |
| Synonyms | Source |
|---|---|
| 2-(4,4-difluoropiperidin-1-yl)-6-methoxy-N-(1-propan-2-ylpiperidin-4-yl)-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-amine | SUBMITTER |
| UNC 0642 | ChEBI |
| UNC-0642 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0259403 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:1481677-78-4 | SUBMITTER |
| Citations |
|---|