EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H26N2OS |
| Net Charge | 0 |
| Average Mass | 294.464 |
| Monoisotopic Mass | 294.17658 |
| SMILES | CN[C@@H](C)Cc1ccc(NC(=O)CCCCCS)cc1 |
| InChI | InChI=1S/C16H26N2OS/c1-13(17-2)12-14-7-9-15(10-8-14)18-16(19)6-4-3-5-11-20/h7-10,13,17,20H,3-6,11-12H2,1-2H3,(H,18,19)/t13-/m0/s1 |
| InChIKey | PZAHLKRSTAOQKY-ZDUSSCGKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-{4-[(2S)-2-(methylamino)propyl]phenyl}-6-sulfanylhexanamide (CHEBI:233627) has role hapten (CHEBI:59174) |
| N-{4-[(2S)-2-(methylamino)propyl]phenyl}-6-sulfanylhexanamide (CHEBI:233627) is a aromatic amide (CHEBI:62733) |
| N-{4-[(2S)-2-(methylamino)propyl]phenyl}-6-sulfanylhexanamide (CHEBI:233627) is a benzenes (CHEBI:22712) |
| N-{4-[(2S)-2-(methylamino)propyl]phenyl}-6-sulfanylhexanamide (CHEBI:233627) is a secondary amino compound (CHEBI:50995) |
| N-{4-[(2S)-2-(methylamino)propyl]phenyl}-6-sulfanylhexanamide (CHEBI:233627) is a secondary carboxamide (CHEBI:140325) |
| N-{4-[(2S)-2-(methylamino)propyl]phenyl}-6-sulfanylhexanamide (CHEBI:233627) is a thiol (CHEBI:29256) |
| IUPAC Name |
|---|
| N-{4-[(2S)-2-(methylamino)propyl]phenyl}-6-sulfanylhexanamide |
| Synonym | Source |
|---|---|
| MH7 | ChEBI |
| Citations |
|---|