EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H25NS |
| Net Charge | 0 |
| Average Mass | 251.439 |
| Monoisotopic Mass | 251.17077 |
| SMILES | C[C@@H](Cc1ccccc1)NCCCCCCS |
| InChI | InChI=1S/C15H25NS/c1-14(13-15-9-5-4-6-10-15)16-11-7-2-3-8-12-17/h4-6,9-10,14,16-17H,2-3,7-8,11-13H2,1H3/t14-/m0/s1 |
| InChIKey | QBJNZLOYWBZWRP-AWEZNQCLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-{[(2S)-1-phenylpropan-2-yl]amino}hexane-1-thiol (CHEBI:233626) has role hapten (CHEBI:59174) |
| 6-{[(2S)-1-phenylpropan-2-yl]amino}hexane-1-thiol (CHEBI:233626) is a benzenes (CHEBI:22712) |
| 6-{[(2S)-1-phenylpropan-2-yl]amino}hexane-1-thiol (CHEBI:233626) is a secondary amino compound (CHEBI:50995) |
| 6-{[(2S)-1-phenylpropan-2-yl]amino}hexane-1-thiol (CHEBI:233626) is a thiol (CHEBI:29256) |
| IUPAC Name |
|---|
| 6-{[(2S)-1-phenylpropan-2-yl]amino}hexane-1-thiol |
| Synonym | Source |
|---|---|
| MH6 | ChEBI |
| Citations |
|---|