EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H26N2OS |
| Net Charge | 0 |
| Average Mass | 306.475 |
| Monoisotopic Mass | 306.17658 |
| SMILES | O=C(CCCCCS)N1CCN[C@H](Cc2ccccc2)C1 |
| InChI | InChI=1S/C17H26N2OS/c20-17(9-5-2-6-12-21)19-11-10-18-16(14-19)13-15-7-3-1-4-8-15/h1,3-4,7-8,16,18,21H,2,5-6,9-14H2/t16-/m1/s1 |
| InChIKey | DLSWYBIIWCQHQD-MRXNPFEDSA-N |
| Roles Classification |
|---|
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-[(3R)-3-benzylpiperazin-1-yl]-6-sulfanylhexan-1-one (CHEBI:233625) has role hapten (CHEBI:59174) |
| 1-[(3R)-3-benzylpiperazin-1-yl]-6-sulfanylhexan-1-one (CHEBI:233625) is a N-acylpiperazine (CHEBI:46844) |
| 1-[(3R)-3-benzylpiperazin-1-yl]-6-sulfanylhexan-1-one (CHEBI:233625) is a benzenes (CHEBI:22712) |
| 1-[(3R)-3-benzylpiperazin-1-yl]-6-sulfanylhexan-1-one (CHEBI:233625) is a tertiary carboxamide (CHEBI:140326) |
| 1-[(3R)-3-benzylpiperazin-1-yl]-6-sulfanylhexan-1-one (CHEBI:233625) is a thiol (CHEBI:29256) |
| IUPAC Name |
|---|
| 1-[(3R)-3-benzylpiperazin-1-yl]-6-sulfanylhexan-1-one |
| Synonym | Source |
|---|---|
| MH2(R) | ChEBI |
| Citations |
|---|