EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H5O4 |
| Net Charge | -1 |
| Average Mass | 153.113 |
| Monoisotopic Mass | 153.01933 |
| SMILES | CC1=C([O-])C(=O)[C@@H]2O[C@@H]2C1=O |
| InChI | InChI=1S/C7H6O4/c1-2-3(8)5(10)7-6(11-7)4(2)9/h6-8H,1H3/p-1/t6-,7+/m1/s1 |
| InChIKey | ATFNSNUJZOYXFC-RQJHMYQMSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| terreate (CHEBI:233617) is a organic anion (CHEBI:25696) |
| terreate (CHEBI:233617) is conjugate base of terreic acid (CHEBI:156546) |
| Incoming Relation(s) |
| terreic acid (CHEBI:156546) is conjugate acid of terreate (CHEBI:233617) |
| UniProt Name | Source |
|---|---|
| terreate | UniProt |
| Citations |
|---|