EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H12N2O2 |
| Net Charge | 0 |
| Average Mass | 156.185 |
| Monoisotopic Mass | 156.08988 |
| SMILES | CC(C)C[C@@H]1NC(=O)NC1=O |
| InChI | InChI=1S/C7H12N2O2/c1-4(2)3-5-6(10)9-7(11)8-5/h4-5H,3H2,1-2H3,(H2,8,9,10,11)/t5-/m0/s1 |
| InChIKey | WLRZLHCGXUHRIG-YFKPBYRVSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-5-isobutylhydantoin (CHEBI:233610) is a benzenes (CHEBI:22712) |
| L-5-isobutylhydantoin (CHEBI:233610) is a imidazolidine-2,4-dione (CHEBI:24628) |
| L-5-isobutylhydantoin (CHEBI:233610) is enantiomer of D-5-isobutylhydantoin (CHEBI:233609) |
| Incoming Relation(s) |
| D-5-isobutylhydantoin (CHEBI:233609) is enantiomer of L-5-isobutylhydantoin (CHEBI:233610) |
| Synonym | Source |
|---|---|
| (5S)-5-isobutylhydantoin | SUBMITTER |
| UniProt Name | Source |
|---|---|
| L-5-isobutylhydantoin | UniProt |
| Citations |
|---|