EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10N2O2 |
| Net Charge | 0 |
| Average Mass | 142.158 |
| Monoisotopic Mass | 142.07423 |
| SMILES | CC(C)[C@@H]1NC(=O)NC1=O |
| InChI | InChI=1S/C6H10N2O2/c1-3(2)4-5(9)8-6(10)7-4/h3-4H,1-2H3,(H2,7,8,9,10)/t4-/m0/s1 |
| InChIKey | PBNUQCWZHRMSMS-BYPYZUCNSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-5-isopropylhydantoin (CHEBI:233608) is a benzenes (CHEBI:22712) |
| L-5-isopropylhydantoin (CHEBI:233608) is a imidazolidine-2,4-dione (CHEBI:24628) |
| L-5-isopropylhydantoin (CHEBI:233608) is enantiomer of D-5-isopropylhydantoin (CHEBI:233607) |
| Incoming Relation(s) |
| D-5-isopropylhydantoin (CHEBI:233607) is enantiomer of L-5-isopropylhydantoin (CHEBI:233608) |
| Synonym | Source |
|---|---|
| (5S)-5-isopropylhydantoin | SUBMITTER |
| UniProt Name | Source |
|---|---|
| L-5-isopropylhydantoin | UniProt |
| Citations |
|---|