EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H28N2O |
| Net Charge | 0 |
| Average Mass | 348.490 |
| Monoisotopic Mass | 348.22016 |
| SMILES | O=C(C1CC1)N(c1ccccc1)C1CCN(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C23H28N2O/c26-23(20-11-12-20)25(21-9-5-2-6-10-21)22-14-17-24(18-15-22)16-13-19-7-3-1-4-8-19/h1-10,20,22H,11-18H2 |
| InChIKey | OIQSKDSKROTEMN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| Applications: | mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyclopropylfentanyl (CHEBI:233606) has role opioid analgesic (CHEBI:35482) |
| cyclopropylfentanyl (CHEBI:233606) has role μ-opioid receptor agonist (CHEBI:55322) |
| cyclopropylfentanyl (CHEBI:233606) is a anilide (CHEBI:13248) |
| cyclopropylfentanyl (CHEBI:233606) is a cyclopropylcarboxamide (CHEBI:51456) |
| cyclopropylfentanyl (CHEBI:233606) is a monocarboxylic acid amide (CHEBI:29347) |
| cyclopropylfentanyl (CHEBI:233606) is a piperidines (CHEBI:26151) |
| cyclopropylfentanyl (CHEBI:233606) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N-phenyl-N-[1-(2-phenylethyl)piperidin-4-yl]cyclopropanecarboxamide |
| Synonyms | Source |
|---|---|
| cyclopropyl fentanyl | ChEBI |
| cyclopropyl-fentanyl | ChEBI |
| N-(1-phenethyl-4-piperidyl)cyclopropanecarboxanilide | ChEBI |
| N-phenyl-N-[1-(2-phenylethyl)-4-piperidinyl]cyclopropanecarboxamide | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C22757 | KEGG COMPOUND |
| Cyclopropylfentanyl | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:1169-68-2 | ChEBI |
| Citations |
|---|