EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H16ClN5O |
| Net Charge | 0 |
| Average Mass | 365.824 |
| Monoisotopic Mass | 365.10434 |
| SMILES | Clc1ccc(-n2ccc(OCCNc3ncnc4ccccc34)n2)cc1 |
| InChI | InChI=1S/C19H16ClN5O/c20-14-5-7-15(8-6-14)25-11-9-18(24-25)26-12-10-21-19-16-3-1-2-4-17(16)22-13-23-19/h1-9,11,13H,10,12H2,(H,21,22,23) |
| InChIKey | XZMCIUKVFDRUPM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | fungicide A substance used to destroy fungal pests. |
| Application: | fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| quinaminoprole (CHEBI:233600) has role fungicide (CHEBI:24127) |
| quinaminoprole (CHEBI:233600) is a aromatic amine (CHEBI:33860) |
| quinaminoprole (CHEBI:233600) is a aromatic ether (CHEBI:35618) |
| quinaminoprole (CHEBI:233600) is a monochlorobenzenes (CHEBI:83403) |
| quinaminoprole (CHEBI:233600) is a pyrazoles (CHEBI:26410) |
| quinaminoprole (CHEBI:233600) is a quinazolines (CHEBI:38530) |
| quinaminoprole (CHEBI:233600) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| N-(2-{[1-(4-chlorophenyl)-1H-pyrazol-3-yl]oxy}ethyl)quinazolin-4-amine |
| Synonym | Source |
|---|---|
| N-[2-[[1-(4-chlorophenyl)-1H-pyrazol-3-yl]oxy]ethyl]-4-quinazolinamine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:32911036 | Reaxys |
| CAS:2049581-78-2 | ChEBI |