EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H21ClN4O2 |
| Net Charge | 0 |
| Average Mass | 360.845 |
| Monoisotopic Mass | 360.13530 |
| SMILES | [H][C@]1(C(=O)Nc2cnn(C)c2Cl)C(=O)N(C)C[C@]1([H])c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C18H21ClN4O2/c1-10-5-11(2)7-12(6-10)13-9-22(3)18(25)15(13)17(24)21-14-8-20-23(4)16(14)19/h5-8,13,15H,9H2,1-4H3,(H,21,24)/t13-,15+/m1/s1 |
| InChIKey | TVVANMBOCNCMID-HIFRSBDPSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dimepyrolimet (CHEBI:233598) has role herbicide (CHEBI:24527) |
| dimepyrolimet (CHEBI:233598) is a methylbenzene (CHEBI:38975) |
| dimepyrolimet (CHEBI:233598) is a organochlorine compound (CHEBI:36683) |
| dimepyrolimet (CHEBI:233598) is a pyrazoles (CHEBI:26410) |
| dimepyrolimet (CHEBI:233598) is a pyrrolidinone (CHEBI:38275) |
| dimepyrolimet (CHEBI:233598) is a secondary carboxamide (CHEBI:140325) |
| dimepyrolimet (CHEBI:233598) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| (3S,4S)-N-(5-chloro-1-methyl-1H-pyrazol-4-yl)-4-(3,5-dimethylphenyl)-1-methyl-2-oxopyrrolidine-3-carboxamide |
| Synonym | Source |
|---|---|
| (3S,4S)-N-(5-chloro-1-methyl-1H-pyrazol-4-yl)-4-(3,5-dimethylphenyl)-1-methyl-2-oxo-3-pyrrolidinecarboxamide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:61148991 | Reaxys |
| CAS:3056779-02-0 | ChEBI |