EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16N2O4S |
| Net Charge | 0 |
| Average Mass | 248.304 |
| Monoisotopic Mass | 248.08308 |
| SMILES | [H][C@]12O[C@H](CO)[C@@H](O)[C@H](O)[C@@]1([H])N=C(NCC)S2 |
| InChI | InChI=1S/C9H16N2O4S/c1-2-10-9-11-5-7(14)6(13)4(3-12)15-8(5)16-9/h4-8,12-14H,2-3H2,1H3,(H,10,11)/t4-,5-,6-,7-,8-/m1/s1 |
| InChIKey | PPAIMZHKIXDJRN-FMDGEEDCSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 3.2.1.169 (protein O-GlcNAcase) inhibitor An EC 3.2.1.* (glycosidase) inhibitor that interferes with the action of protein O-GlcNAcase (EC 3.2.1.169). chemosensitiser Any compound that can sensitise tumour cells to chemotherapy. |
| Application: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thiamet G (CHEBI:233586) has role chemosensitiser (CHEBI:233442) |
| thiamet G (CHEBI:233586) has role EC 3.2.1.169 (protein O-GlcNAcase) inhibitor (CHEBI:234036) |
| thiamet G (CHEBI:233586) has role neuroprotective agent (CHEBI:63726) |
| thiamet G (CHEBI:233586) is a pyranothiazole (CHEBI:48880) |
| thiamet G (CHEBI:233586) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| (3aR,5R,6S,7R,7aR)-2-(ethylamino)-5-(hydroxymethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol |
| Synonyms | Source |
|---|---|
| 2-(ethylamino)-3aR,6S,7R,7aR-tetrahydro-5R-(hydroxymethyl)-5H-pyrano[3,2-d]thiazole-6,7-diol | ChEBI |
| thiamet-G | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:1009816-48-1 | SUBMITTER |
| Citations |
|---|