EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H10F2N6O |
| Net Charge | 0 |
| Average Mass | 340.293 |
| Monoisotopic Mass | 340.08842 |
| SMILES | Fc1ccccc1Nc1nc2nonc2nc1Nc1ccccc1F |
| InChI | InChI=1S/C16H10F2N6O/c17-9-5-1-3-7-11(9)19-13-14(20-12-8-4-2-6-10(12)18)22-16-15(21-13)23-25-24-16/h1-8H,(H,19,21,23)(H,20,22,24) |
| InChIKey | OEGJBRZAJRPPHL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. anti-obesity agent Any substance which is used to reduce or control weight. |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. anti-inflammatory agent Any compound that has anti-inflammatory effects. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. renoprotective agent Any compound that is able to prevent damage to the kidneys. antiparasitic agent A substance used to treat or prevent parasitic infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| BAM15 (CHEBI:233585) has role anti-inflammatory agent (CHEBI:67079) |
| BAM15 (CHEBI:233585) has role anti-obesity agent (CHEBI:74518) |
| BAM15 (CHEBI:233585) has role antineoplastic agent (CHEBI:35610) |
| BAM15 (CHEBI:233585) has role antiparasitic agent (CHEBI:35442) |
| BAM15 (CHEBI:233585) has role apoptosis inducer (CHEBI:68495) |
| BAM15 (CHEBI:233585) has role geroprotector (CHEBI:176497) |
| BAM15 (CHEBI:233585) has role renoprotective agent (CHEBI:231911) |
| BAM15 (CHEBI:233585) is a monofluorobenzenes (CHEBI:83575) |
| BAM15 (CHEBI:233585) is a organic heterobicyclic compound (CHEBI:27171) |
| BAM15 (CHEBI:233585) is a secondary amino compound (CHEBI:50995) |
| BAM15 (CHEBI:233585) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| N,N'-bis(2-fluorophenyl)[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine |
| Synonyms | Source |
|---|---|
| 5-N,6-N-bis(2-fluorophenyl)-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine | ChEBI |
| N5,N6-bis(2-fluorophenyl)[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine | IUPAC |
| BAM 15 | ChEBI |
| BAM-15 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| BAM15 | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:210302-17-3 | SUBMITTER |
| Citations |
|---|