EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:233584 - trimedoxime bromide
| Formula | C15H16N4O2.2HBr |
| Net Charge | 0 |
| Average Mass | 446.143 |
| Monoisotopic Mass | 443.97965 |
| SMILES | Br.Br.O=NC=C1C=CN(CCCN2C=CC(=CN=O)C=C2)C=C1 |
| InChI | InChI=1S/C15H16N4O2.2BrH/c20-16-12-14-2-8-18(9-3-14)6-1-7-19-10-4-15(5-11-19)13-17-21;;/h2-5,8-13H,1,6-7H2;2*1H |
| InChIKey | JHZHWVQTOXIXIV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | cholinesterase reactivator A drug used to reverse the inactivation of cholinesterase caused by organophosphates or sulfonates. |
| Application: | antidote to organophosphate poisoning A role borne by a molecule that acts to counteract or neutralise the deleterious effects of organophosphates or acetylcholinesterase inhibitors (nerve agents). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trimedoxime bromide (CHEBI:233584) has role antidote to organophosphate poisoning (CHEBI:90753) |
| trimedoxime bromide (CHEBI:233584) has role cholinesterase reactivator (CHEBI:50241) |
| trimedoxime bromide (CHEBI:233584) is a organic molecular entity (CHEBI:50860) |
| Registry Numbers | Sources |
|---|---|
| CAS:56-97-3 | SUBMITTER |
| Citations |
|---|