EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H16N4O3 |
| Net Charge | +2 |
| Average Mass | 288.307 |
| Monoisotopic Mass | 288.12114 |
| SMILES | O=[NH+]C=C1C=CN(COCN2C=CC(=C[NH+]=O)C=C2)C=C1 |
| InChI | InChI=1S/C14H14N4O3/c19-15-9-13-1-5-17(6-2-13)11-21-12-18-7-3-14(4-8-18)10-16-20/h1-10H,11-12H2/p+2 |
| InChIKey | HIGRLDNHDGYWQJ-UHFFFAOYSA-P |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | cholinesterase reactivator A drug used to reverse the inactivation of cholinesterase caused by organophosphates or sulfonates. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| obidoxime (CHEBI:233583) has role cholinesterase reactivator (CHEBI:50241) |
| obidoxime (CHEBI:233583) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| (NE)-N-[[1-[[4-[(E)-hydroxyiminomethyl]pyridin-1-ium-1-yl]methoxymethyl]pyridin-1-ium-4-yl]methylidene]hydroxylamine |
| Manual Xrefs | Databases |
|---|---|
| DB13750 | DrugBank |
| https://en.wikipedia.org/wiki/Obidoxime | Wikipedia |
| Citations |
|---|