EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16N4O2.2HBr |
| Net Charge | 0 |
| Average Mass | 446.143 |
| Monoisotopic Mass | 443.97965 |
| SMILES | Br.Br.[NH-]C(=O)c1cc[n+](CCCN2C=CC(=CN=O)C=C2)cc1 |
| InChI | InChI=1S/C15H16N4O2.2BrH/c16-15(20)14-4-10-19(11-5-14)7-1-6-18-8-2-13(3-9-18)12-17-21;;/h2-5,8-12H,1,6-7H2,(H-,16,20);2*1H |
| InChIKey | GUKLPXXRDXZMIV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | cholinesterase reactivator A drug used to reverse the inactivation of cholinesterase caused by organophosphates or sulfonates. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| K027 (CHEBI:233580) has role cholinesterase reactivator (CHEBI:50241) |
| K027 (CHEBI:233580) is a oxime (CHEBI:25750) |
| IUPAC Name |
|---|
| 1-[3-[4-[(E)-hydroxyiminomethyl]pyridin-1-ium-1-yl]propyl]pyridin-1-ium-4-carboxamide;dibromide |
| Citations |
|---|