EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:233575 - 7-methyltricosane
| Formula | C24H50 |
| Net Charge | 0 |
| Average Mass | 338.664 |
| Monoisotopic Mass | 338.39125 |
| SMILES | CCCCCCCCCCCCCCCCC(C)CCCCCC |
| InChI | InChI=1S/C24H50/c1-4-6-8-10-11-12-13-14-15-16-17-18-19-21-23-24(3)22-20-9-7-5-2/h24H,4-23H2,1-3H3 |
| InChIKey | ULRDOMATUJWTEF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-methyltricosane (CHEBI:233575) has role animal metabolite (CHEBI:75767) |
| 7-methyltricosane (CHEBI:233575) has role pheromone (CHEBI:26013) |
| 7-methyltricosane (CHEBI:233575) is a alkane (CHEBI:18310) |
| Manual Xrefs | Databases |
|---|---|
| LMFA11000518 | LIPID MAPS |
| Citations |
|---|