EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H56 |
| Net Charge | 0 |
| Average Mass | 380.745 |
| Monoisotopic Mass | 380.43820 |
| SMILES | CCCCCCCCCCCCCCCCCCCCCCCCC(C)C |
| InChI | InChI=1S/C27H56/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27(2)3/h27H,4-26H2,1-3H3 |
| InChIKey | BEBPORIYFVRVCP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Graptophyllum pictum (ncbitaxon:1382148) | - | PubMed (38742815) | |
| Lepidium sativum (ncbitaxon:33125) | seed (BTO:0001226) | PubMed (37895159) | |
| Rosa hybrid cultivar (ncbitaxon:128735) | - | PubMed (32957603) | Species also known as Rosa hybrida. |
| Santolina chamaecyparissus (ncbitaxon:41644) | - | PubMed (34354443) |
| Roles Classification |
|---|
| Biological Roles: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methylhexacosane (CHEBI:233573) has role animal metabolite (CHEBI:75767) |
| 2-methylhexacosane (CHEBI:233573) has role pheromone (CHEBI:26013) |
| 2-methylhexacosane (CHEBI:233573) has role plant metabolite (CHEBI:76924) |
| 2-methylhexacosane (CHEBI:233573) is a long-chain alkane (CHEBI:83563) |
| IUPAC Name |
|---|
| 2-methylhexacosane |
| Synonyms | Source |
|---|---|
| 2-Me-C26 | ChEBI |
| 2Me-C26 | ChEBI |
| 2-methyl-n-hexacosane | ChEBI |
| isoheptacosane | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C00060126 | KNApSAcK |
| HMDB0032661 | HMDB |
| LMFA11000345 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:1561-02-0 | NIST Chemistry WebBook |
| Citations |
|---|