EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14O4 |
| Net Charge | 0 |
| Average Mass | 270.284 |
| Monoisotopic Mass | 270.08921 |
| SMILES | [H]C(/C(OC)=C1\C(=O)C=C(OC)C1=O)=C(/[H])c1ccccc1 |
| InChI | InChI=1S/C16H14O4/c1-19-13(9-8-11-6-4-3-5-7-11)15-12(17)10-14(20-2)16(15)18/h3-10H,1-2H3/b9-8+,15-13- |
| InChIKey | FITVJPYUOAZKPN-PBMBQWDMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lindera erythrocarpa (ncbitaxon:128639) | - | PubMed (31875458) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyllucidone (CHEBI:233572) has role antioxidant (CHEBI:22586) |
| methyllucidone (CHEBI:233572) is a chalcones (CHEBI:23086) |
| IUPAC Name |
|---|
| (2Z)-4-methoxy-2-[(E)-1-methoxy-3-phenylprop-2-enylidene]cyclopent-4-ene-1,3-dione |
| Synonym | Source |
|---|---|
| methyl lucidone | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| LMPK12120440 | LIPID MAPS |
| Citations |
|---|