EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H19F2NO3 |
| Net Charge | 0 |
| Average Mass | 371.383 |
| Monoisotopic Mass | 371.13330 |
| SMILES | CCOc1ccc(Oc2ccc(OCc3cc(F)ccc3F)cc2)c(N)c1 |
| InChI | InChI=1S/C21H19F2NO3/c1-2-25-18-8-10-21(20(24)12-18)27-17-6-4-16(5-7-17)26-13-14-11-15(22)3-9-19(14)23/h3-12H,2,13,24H2,1H3 |
| InChIKey | YSUBLPUJDOWYDP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | inhibitor A substance that diminishes the rate of a chemical reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SEA0400 (CHEBI:233563) has role inhibitor (CHEBI:35222) |
| SEA0400 (CHEBI:233563) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 2-[4-[(2,5-difluorophenyl)methoxy]phenoxy]-5-ethoxyaniline |
| Manual Xrefs | Databases |
|---|---|
| HMDB0258196 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:223104-29-8 | SUBMITTER |
| Citations |
|---|