EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H16O5 |
| Net Charge | 0 |
| Average Mass | 300.310 |
| Monoisotopic Mass | 300.09977 |
| SMILES | [H]/C(C(OC)=C1C(=O)C(OC)=C(OC)C1=O)=C(/[H])c1ccccc1 |
| InChI | InChI=1S/C17H16O5/c1-20-12(10-9-11-7-5-4-6-8-11)13-14(18)16(21-2)17(22-3)15(13)19/h4-10H,1-3H3/b10-9+ |
| InChIKey | KXRUALBXWXRUTD-MDZDMXLPSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lindera erythrocarpa (ncbitaxon:128639) | - | PubMed (29937519) |
| Roles Classification |
|---|
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-inflammatory drug A substance that reduces or suppresses inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyllinderone (CHEBI:233555) has role anti-inflammatory drug (CHEBI:35472) |
| methyllinderone (CHEBI:233555) has role antineoplastic agent (CHEBI:35610) |
| methyllinderone (CHEBI:233555) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 4,5-dimethoxy-2-[(E)-1-methoxy-3-phenylprop-2-enylidene]cyclopent-4-ene-1,3-dione |
| Manual Xrefs | Databases |
|---|---|
| LMPK12120438 | LIPID MAPS |
| https://en.wikipedia.org/wiki/Methyllinderone | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:3984-73-4 | SUBMITTER |
| Citations |
|---|